| Availability: | |
|---|---|
| Quantity: | |
| Product Name | Triacetin |
| Alias | 1,2,3-Propanetriol triacetate; Glycerol Triacetate, USP Grade(1.03000); TRIACETINE; Glycerol triacetate; Glyceryl triacetate; propane-1,2,3-triyl triacetate |
| CAS NO. | 102-76-1 |
| Molecular formula | C9H14O6 |
| Molecular weight | 218.2039 |
| EINECS NO. | 203-051-9 |
| InChI | InChI=1/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
| Molecular structure | ![]() |
| Application | Used as chromatographic stationary liquid, solvent, plasticizer and perfume fixative |
| Density | 1.161g/cm3 |
| Melting point | 3℃ |
| Boiling point | 258°C at 760 mmHg |
| Flash point | 93.9°C |
| Water soluble | 64.0 g/L (20℃) |
| Vapor pressure | 0.0141mmHg at 25°C |
| Product Name | Triacetin |
| Alias | 1,2,3-Propanetriol triacetate; Glycerol Triacetate, USP Grade(1.03000); TRIACETINE; Glycerol triacetate; Glyceryl triacetate; propane-1,2,3-triyl triacetate |
| CAS NO. | 102-76-1 |
| Molecular formula | C9H14O6 |
| Molecular weight | 218.2039 |
| EINECS NO. | 203-051-9 |
| InChI | InChI=1/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
| Molecular structure | ![]() |
| Application | Used as chromatographic stationary liquid, solvent, plasticizer and perfume fixative |
| Density | 1.161g/cm3 |
| Melting point | 3℃ |
| Boiling point | 258°C at 760 mmHg |
| Flash point | 93.9°C |
| Water soluble | 64.0 g/L (20℃) |
| Vapor pressure | 0.0141mmHg at 25°C |
Home | Products | Company | Solutions | Download | Blog | Contact Us | Privacy Policy